Eintrag in der Universitätsbibliographie der TU Chemnitz
El-khateeb, Mohammad ; Jibril, Ibrahim ; Barakat, Hisham ; Rheinwald, Gerd ; Lang, Heinrich
Controlled synthesis of mono-substituted diphosphine iron thiocarboxylate complexes CpFe(CO)(Ph2P(CH2)nPPh2)SCOR [n=1 (dppm), n=2 (dppe)]. X-ray crystal structure of CpFe(CO)(dppm-S)SCO-3,5-(NO2)2C6H3
Universität: | Technische Universität Chemnitz | |
Institut: | Professur Anorganische Chemie | |
Dokumentart: | Artikel in Fachzeitschrift, referiert | |
ISBN/ISSN: | ISSN: 0277-5387 | |
URL/URN: | http://dx.doi.org/10.1016/j.poly.2003.08.005 | |
Quelle: | In: Polyhedron. - 22. 2003, 27, S. 3445 - 3449 |